Products 936022-02-5

CAS 936022-02-5 is the registry number for Mono-(7-carboxy-4-methylheptyl) Phthalate, >95% (HPLC). Offered by: TRC. Available pack sizes: 50mg, 5mg.

Structural formula: {0} (CAS {1})

2-(7-carboxy-4-methylheptoxy)carbonylbenzoic acid (CAS 936022-02-5) is a chemical compound with the molecular formula C17H22O6 and a molecular weight of 322.4 g/mol. IUPAC name: 2-(7-carboxy-4-methylheptoxy)carbonylbenzoic acid. InChIKey: IGGGGTKTEAEHSG-UHFFFAOYSA-N.

Identity
Molecular formulaC17H22O6
Molecular weight322.4 g/mol
IUPAC name2-(7-carboxy-4-methylheptoxy)carbonylbenzoic acid
InChIKeyIGGGGTKTEAEHSG-UHFFFAOYSA-N
SMILESCC(CCCC(=O)O)CCCOC(=O)C1=CC=CC=C1C(=O)O

Computed by PubChem (NCBI)