CAS 1333122-75-0 appears in our catalog under these names: 4,5-Difluoro-2-(methoxycarbonyl)phenylboronic acid pinacol ester, 97%, Methyl 4,5-difluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 97%, 4,5-Difluoro-2-(methoxycarbonyl)phenylboronic acid pinacol ester, 4,5-Difluoro-2-(methoxycarbonyl)phenylboronic acid pinacol ester, 97%, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
Methyl 4,5-difluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 1333122-75-0) is a chemical compound with the molecular formula C14H17BF2O4 and a molecular weight of 298.09 g/mol. IUPAC name: methyl 4,5-difluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: JFKWYMUPUWCUSK-UHFFFAOYSA-N.
| Molecular formula | C14H17BF2O4 |
|---|---|
| Molecular weight | 298.09 g/mol |
| IUPAC name | methyl 4,5-difluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | JFKWYMUPUWCUSK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2C(=O)OC)F)F |
Computed by PubChem (NCBI)