Products 1639804-61-7
CAS 1639804-61-7 is the registry number for Methyl 2,3-difluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 95%. Offered by: Fluorochem. Available pack sizes: 50mg, 100mg.
Methyl 2,3-difluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 1639804-61-7) is a chemical compound with the molecular formula C14H17BF2O4 and a molecular weight of 298.09 g/mol. IUPAC name: methyl 2,3-difluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: KCSOQERHJHGDEA-UHFFFAOYSA-N.
| Molecular formula | C14H17BF2O4 |
|---|---|
| Molecular weight | 298.09 g/mol |
| IUPAC name | methyl 2,3-difluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | KCSOQERHJHGDEA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=C(C=C2)F)F)C(=O)OC |
Computed by PubChem (NCBI)