Products 1629914-22-2
CAS 1629914-22-2 is the registry number for Methyl 2,4-difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 98%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Methyl 2,4-difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 1629914-22-2) is a chemical compound with the molecular formula C14H17BF2O4 and a molecular weight of 298.09 g/mol. IUPAC name: methyl 2,4-difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: AJDDJRPDVKRQMF-UHFFFAOYSA-N.
| Molecular formula | C14H17BF2O4 |
|---|---|
| Molecular weight | 298.09 g/mol |
| IUPAC name | methyl 2,4-difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | AJDDJRPDVKRQMF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2F)F)C(=O)OC |
Computed by PubChem (NCBI)