CAS 1333375-53-3 appears in our catalog under these names: (S-​(Difluoromethyl)​sulfonimidoyl)​-benzene, [S-(Difluoromethyl)sulfonimidoyl]benzene, 97%. Offered by: Biosynth, Fluorochem. Available pack sizes: 0,5g, 50mg, 100mg, 250mg.
Difluoromethyl-imino-oxo-phenyl-lambda6-sulfane (CAS 1333375-53-3) is a chemical compound with the molecular formula C7H7F2NOS and a molecular weight of 191.20 g/mol. IUPAC name: difluoromethyl-imino-oxo-phenyl-lambda6-sulfane. InChIKey: OVTMRPQANBHQPY-UHFFFAOYSA-N.
| Molecular formula | C7H7F2NOS |
|---|---|
| Molecular weight | 191.20 g/mol |
| IUPAC name | difluoromethyl-imino-oxo-phenyl-lambda6-sulfane |
| InChIKey | OVTMRPQANBHQPY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=N)(=O)C(F)F |
Computed by PubChem (NCBI)