CAS 1333540-43-4 is the registry number for 4-((2-Phenylethyl)amino)phenol hydrobromide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(2-phenylethylamino)phenol;hydrobromide (CAS 1333540-43-4) is a chemical compound with the molecular formula C14H16BrNO and a molecular weight of 294.19 g/mol. IUPAC name: 4-(2-phenylethylamino)phenol;hydrobromide. InChIKey: DMTLBBSBNZOOTH-UHFFFAOYSA-N.
| Molecular formula | C14H16BrNO |
|---|---|
| Molecular weight | 294.19 g/mol |
| IUPAC name | 4-(2-phenylethylamino)phenol;hydrobromide |
| InChIKey | DMTLBBSBNZOOTH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCNC2=CC=C(C=C2)O.Br |
Computed by PubChem (NCBI)