Products 1333710-30-7
CAS 1333710-30-7 appears in our catalog under these names: 2-Phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-ol, 95%, 2-Phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-ol (CAS 1333710-30-7) is a chemical compound with the molecular formula C13H13NOS and a molecular weight of 231.32 g/mol. IUPAC name: 2-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-ol. InChIKey: KQQIRFYLRZBNPW-UHFFFAOYSA-N.
| Molecular formula | C13H13NOS |
|---|---|
| Molecular weight | 231.32 g/mol |
| IUPAC name | 2-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-ol |
| InChIKey | KQQIRFYLRZBNPW-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)N=C(S2)C3=CC=CC=C3)O |
Computed by PubChem (NCBI)