CAS 937598-06-6 appears in our catalog under these names: 1-(2-Benzyl-4-methyl-1,3-thiazol-5-yl)ethan-1-one, 95%, 1-(2-Benzyl-4-methyl-1,3-thiazol-5-yl)ethan-1-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g, 0,5g.
1-(2-benzyl-4-methyl-1,3-thiazol-5-yl)ethanone (CAS 937598-06-6) is a chemical compound with the molecular formula C13H13NOS and a molecular weight of 231.32 g/mol. IUPAC name: 1-(2-benzyl-4-methyl-1,3-thiazol-5-yl)ethanone. InChIKey: OPDVFVZVSSJRPL-UHFFFAOYSA-N.
| Molecular formula | C13H13NOS |
|---|---|
| Molecular weight | 231.32 g/mol |
| IUPAC name | 1-(2-benzyl-4-methyl-1,3-thiazol-5-yl)ethanone |
| InChIKey | OPDVFVZVSSJRPL-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)CC2=CC=CC=C2)C(=O)C |
Computed by PubChem (NCBI)