Products 1340453-00-0
CAS 1340453-00-0 appears in our catalog under these names: 2-Benzoyl-4-(propan-2-yl)-1,3-thiazole, 95%, 2-Benzoyl-4-(propan-2-yl)-1,3-thiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
Phenyl-(4-propan-2-yl-1,3-thiazol-2-yl)methanone (CAS 1340453-00-0) is a chemical compound with the molecular formula C13H13NOS and a molecular weight of 231.32 g/mol. IUPAC name: phenyl-(4-propan-2-yl-1,3-thiazol-2-yl)methanone. InChIKey: GPROSCCXGAYLQK-UHFFFAOYSA-N.
| Molecular formula | C13H13NOS |
|---|---|
| Molecular weight | 231.32 g/mol |
| IUPAC name | phenyl-(4-propan-2-yl-1,3-thiazol-2-yl)methanone |
| InChIKey | GPROSCCXGAYLQK-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CSC(=N1)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)