Products 1333827-63-6
CAS 1333827-63-6 is the registry number for 2-Amino-5-(cyclohexyloxy)-4-fluorobenzoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-amino-5-cyclohexyloxy-4-fluorobenzoic acid (CAS 1333827-63-6) is a chemical compound with the molecular formula C13H16FNO3 and a molecular weight of 253.27 g/mol. IUPAC name: 2-amino-5-cyclohexyloxy-4-fluorobenzoic acid. InChIKey: JBCLCEDFJGXUSY-UHFFFAOYSA-N.
| Molecular formula | C13H16FNO3 |
|---|---|
| Molecular weight | 253.27 g/mol |
| IUPAC name | 2-amino-5-cyclohexyloxy-4-fluorobenzoic acid |
| InChIKey | JBCLCEDFJGXUSY-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)OC2=C(C=C(C(=C2)C(=O)O)N)F |
Computed by PubChem (NCBI)