CAS 1333944-77-6 appears in our catalog under these names: 2-(2-Aminobutan-2-yl)-6-ethyl-3,4-dihydropyrimidin-4-one hydrochloride, 98%, 2-(2-Aminobutan-2-yl)-6-ethyl-3,4-dihydropyrimidin-4-one hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 0,5g, 50mg.
2-(2-aminobutan-2-yl)-4-ethyl-1H-pyrimidin-6-one;hydrochloride (CAS 1333944-77-6) is a chemical compound with the molecular formula C10H18ClN3O and a molecular weight of 231.72 g/mol. IUPAC name: 2-(2-aminobutan-2-yl)-4-ethyl-1H-pyrimidin-6-one;hydrochloride. InChIKey: XBISDYAEHXQQDB-UHFFFAOYSA-N.
| Molecular formula | C10H18ClN3O |
|---|---|
| Molecular weight | 231.72 g/mol |
| IUPAC name | 2-(2-aminobutan-2-yl)-4-ethyl-1H-pyrimidin-6-one;hydrochloride |
| InChIKey | XBISDYAEHXQQDB-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=O)NC(=N1)C(C)(CC)N.Cl |
Computed by PubChem (NCBI)