CAS 1375472-41-5 is the registry number for 1-(5-(Propan-2-yl)-1,2,4-oxadiazol-3-yl)cyclopentan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)cyclopentan-1-amine;hydrochloride (CAS 1375472-41-5) is a chemical compound with the molecular formula C10H18ClN3O and a molecular weight of 231.72 g/mol. IUPAC name: 1-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)cyclopentan-1-amine;hydrochloride. InChIKey: NCCUQRUZDYIJCT-UHFFFAOYSA-N.
| Molecular formula | C10H18ClN3O |
|---|---|
| Molecular weight | 231.72 g/mol |
| IUPAC name | 1-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)cyclopentan-1-amine;hydrochloride |
| InChIKey | NCCUQRUZDYIJCT-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC(=NO1)C2(CCCC2)N.Cl |
Computed by PubChem (NCBI)