CAS 1707367-86-9 is the registry number for 2–Isopropyl–1,3,8–triazaspiro(4·5)dec–1–en–4–one hydrochloride. Offered by: GLPBio. Available pack sizes: 1g.
2-propan-2-yl-1,3,8-triazaspiro[4.5]dec-1-en-4-one;hydrochloride (CAS 1707367-86-9) is a chemical compound with the molecular formula C10H18ClN3O and a molecular weight of 231.72 g/mol. IUPAC name: 2-propan-2-yl-1,3,8-triazaspiro[4.5]dec-1-en-4-one;hydrochloride. InChIKey: NGVDNTLYXYWQKJ-UHFFFAOYSA-N.
| Molecular formula | C10H18ClN3O |
|---|---|
| Molecular weight | 231.72 g/mol |
| IUPAC name | 2-propan-2-yl-1,3,8-triazaspiro[4.5]dec-1-en-4-one;hydrochloride |
| InChIKey | NGVDNTLYXYWQKJ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC2(CCNCC2)C(=O)N1.Cl |
Computed by PubChem (NCBI)