Products 1334146-88-1

CAS 1334146-88-1 is the registry number for 2-Amino-5-(3,3-dimethylmorpholin-4-yl)-4-fluorobenzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-amino-5-(3,3-dimethylmorpholin-4-yl)-4-fluorobenzoic acid (CAS 1334146-88-1) is a chemical compound with the molecular formula C13H17FN2O3 and a molecular weight of 268.28 g/mol. IUPAC name: 2-amino-5-(3,3-dimethylmorpholin-4-yl)-4-fluorobenzoic acid. InChIKey: HHOZKIPIULPDBL-UHFFFAOYSA-N.

Identity
Molecular formulaC13H17FN2O3
Molecular weight268.28 g/mol
IUPAC name2-amino-5-(3,3-dimethylmorpholin-4-yl)-4-fluorobenzoic acid
InChIKeyHHOZKIPIULPDBL-UHFFFAOYSA-N
SMILESCC1(COCCN1C2=C(C=C(C(=C2)C(=O)O)N)F)C

Computed by PubChem (NCBI)