Products 2641113-27-9
CAS 2641113-27-9 is the registry number for Ethyl (S)-4-amino-3-fluoro-5-((oxetan-2-ylmethyl)amino)benzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 4-amino-3-fluoro-5-[[(2S)-oxetan-2-yl]methylamino]benzoate (CAS 2641113-27-9) is a chemical compound with the molecular formula C13H17FN2O3 and a molecular weight of 268.28 g/mol. IUPAC name: ethyl 4-amino-3-fluoro-5-[[(2S)-oxetan-2-yl]methylamino]benzoate. InChIKey: JDBRSVGHRWCTET-VIFPVBQESA-N.
| Molecular formula | C13H17FN2O3 |
|---|---|
| Molecular weight | 268.28 g/mol |
| IUPAC name | ethyl 4-amino-3-fluoro-5-[[(2S)-oxetan-2-yl]methylamino]benzoate |
| InChIKey | JDBRSVGHRWCTET-VIFPVBQESA-N |
| SMILES | CCOC(=O)C1=CC(=C(C(=C1)F)N)NC[C@@H]2CCO2 |
Computed by PubChem (NCBI)