Products 1600493-81-9

CAS 1600493-81-9 is the registry number for 3-(6-Fluoro-pyridin-2-yloxy)-azetidine-1-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 3-[(6-fluoro-2-pyridinyl)oxy]azetidine-1-carboxylate (CAS 1600493-81-9) is a chemical compound with the molecular formula C13H17FN2O3 and a molecular weight of 268.28 g/mol. IUPAC name: tert-butyl 3-[(6-fluoro-2-pyridinyl)oxy]azetidine-1-carboxylate. InChIKey: KFYZAMAEYYFTFG-UHFFFAOYSA-N.

Identity
Molecular formulaC13H17FN2O3
Molecular weight268.28 g/mol
IUPAC nametert-butyl 3-[(6-fluoro-2-pyridinyl)oxy]azetidine-1-carboxylate
InChIKeyKFYZAMAEYYFTFG-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CC(C1)OC2=NC(=CC=C2)F

Computed by PubChem (NCBI)