Products 1334415-21-2

CAS 1334415-21-2 is the registry number for 2-(1-(tert-Butoxycarbonyl)-3-fluoropiperidin-4-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 3-fluoro-4-(2-hydroxyethyl)piperidine-1-carboxylate (CAS 1334415-21-2) is a chemical compound with the molecular formula C12H22FNO3 and a molecular weight of 247.31 g/mol. IUPAC name: tert-butyl 3-fluoro-4-(2-hydroxyethyl)piperidine-1-carboxylate. InChIKey: RTTFSGDFPHCZMD-UHFFFAOYSA-N.

Identity
Molecular formulaC12H22FNO3
Molecular weight247.31 g/mol
IUPAC nametert-butyl 3-fluoro-4-(2-hydroxyethyl)piperidine-1-carboxylate
InChIKeyRTTFSGDFPHCZMD-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(C(C1)F)CCO

Computed by PubChem (NCBI)