CAS 1378026-50-6 is the registry number for Rel-tert-butyl (3R,4S)-3-fluoro-4-(2-hydroxyethyl)piperidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (3R,4S)-3-fluoro-4-(2-hydroxyethyl)piperidine-1-carboxylate (CAS 1378026-50-6) is a chemical compound with the molecular formula C12H22FNO3 and a molecular weight of 247.31 g/mol. IUPAC name: tert-butyl (3R,4S)-3-fluoro-4-(2-hydroxyethyl)piperidine-1-carboxylate. InChIKey: RTTFSGDFPHCZMD-UWVGGRQHSA-N.
| Molecular formula | C12H22FNO3 |
|---|---|
| Molecular weight | 247.31 g/mol |
| IUPAC name | tert-butyl (3R,4S)-3-fluoro-4-(2-hydroxyethyl)piperidine-1-carboxylate |
| InChIKey | RTTFSGDFPHCZMD-UWVGGRQHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]([C@H](C1)F)CCO |
Computed by PubChem (NCBI)