CAS 1612176-00-7 appears in our catalog under these names: Cis-3-fluoro-4-hydroxy-5,5-dimethylpiperidine-1-carboxylic acid tert-butyl ester, 95%, (4R,5S)-rel-tert-Butyl 5-fluoro-4-hydroxy-3,3-dimethylpiperidine-1-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g, 10g.
Tert-butyl (4R,5S)-5-fluoro-4-hydroxy-3,3-dimethylpiperidine-1-carboxylate (CAS 1612176-00-7) is a chemical compound with the molecular formula C12H22FNO3 and a molecular weight of 247.31 g/mol. IUPAC name: tert-butyl (4R,5S)-5-fluoro-4-hydroxy-3,3-dimethylpiperidine-1-carboxylate. InChIKey: ZXQXELYTJRBLOD-IUCAKERBSA-N.
| Molecular formula | C12H22FNO3 |
|---|---|
| Molecular weight | 247.31 g/mol |
| IUPAC name | tert-butyl (4R,5S)-5-fluoro-4-hydroxy-3,3-dimethylpiperidine-1-carboxylate |
| InChIKey | ZXQXELYTJRBLOD-IUCAKERBSA-N |
| SMILES | CC1(CN(C[C@@H]([C@@H]1O)F)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)