Products 1334471-39-4
CAS 1334471-39-4 appears in our catalog under these names: Ebaresdax, Ebaresdax, 99.85%, Ebaresdax, 99%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 5 mg, 10 mg, 100 mg, 50 mg.
(4R)-2-(2-hydroxyanilino)-5,5-dimethyl-4H-1,3-thiazole-4-carboxylic acid (CAS 1334471-39-4) is a chemical compound with the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. IUPAC name: (4R)-2-(2-hydroxyanilino)-5,5-dimethyl-4H-1,3-thiazole-4-carboxylic acid. InChIKey: OASISJWJIHWVKX-SECBINFHSA-N.
| Molecular formula | C12H14N2O3S |
|---|---|
| Molecular weight | 266.32 g/mol |
| IUPAC name | (4R)-2-(2-hydroxyanilino)-5,5-dimethyl-4H-1,3-thiazole-4-carboxylic acid |
| InChIKey | OASISJWJIHWVKX-SECBINFHSA-N |
| SMILES | CC1([C@H](N=C(S1)NC2=CC=CC=C2O)C(=O)O)C |
Computed by PubChem (NCBI)