CAS 1334490-94-6 is the registry number for 2-(4-Fluorophenyl)-6-methyl-3H,4H,5H,6H,7H,8H-pyrido(4,3-d)pyrimidin-4-one, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-(4-fluorophenyl)-6-methyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (CAS 1334490-94-6) is a chemical compound with the molecular formula C14H14FN3O and a molecular weight of 259.28 g/mol. IUPAC name: 2-(4-fluorophenyl)-6-methyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one. InChIKey: KZNVUIRZEGKKJT-UHFFFAOYSA-N.
| Molecular formula | C14H14FN3O |
|---|---|
| Molecular weight | 259.28 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-6-methyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| InChIKey | KZNVUIRZEGKKJT-UHFFFAOYSA-N |
| SMILES | CN1CCC2=C(C1)C(=O)NC(=N2)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)