Products 87628-25-9
CAS 87628-25-9 is the registry number for 1-(3-(4-Fluorophenyl)-1,4,6,7-tetrahydro-5H-pyrazolo[4,3-c]pyridin-5-yl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[3-(4-fluorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]ethanone (CAS 87628-25-9) is a chemical compound with the molecular formula C14H14FN3O and a molecular weight of 259.28 g/mol. IUPAC name: 1-[3-(4-fluorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]ethanone. InChIKey: LJHZPKGRKYDUMY-UHFFFAOYSA-N.
| Molecular formula | C14H14FN3O |
|---|---|
| Molecular weight | 259.28 g/mol |
| IUPAC name | 1-[3-(4-fluorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]ethanone |
| InChIKey | LJHZPKGRKYDUMY-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCC2=C(C1)C(=NN2)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)