CAS 1374414-03-5 is the registry number for 2-(4-Fluorophenyl)-8,8-dimethyl-7,8-dihydroimidazo[1,2-a]pyrazin-6(5h)-one, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-(4-fluorophenyl)-8,8-dimethyl-5,7-dihydroimidazo[1,2-a]pyrazin-6-one (CAS 1374414-03-5) is a chemical compound with the molecular formula C14H14FN3O and a molecular weight of 259.28 g/mol. IUPAC name: 2-(4-fluorophenyl)-8,8-dimethyl-5,7-dihydroimidazo[1,2-a]pyrazin-6-one. InChIKey: GZQJVZDBKJDVBY-UHFFFAOYSA-N.
| Molecular formula | C14H14FN3O |
|---|---|
| Molecular weight | 259.28 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-8,8-dimethyl-5,7-dihydroimidazo[1,2-a]pyrazin-6-one |
| InChIKey | GZQJVZDBKJDVBY-UHFFFAOYSA-N |
| SMILES | CC1(C2=NC(=CN2CC(=O)N1)C3=CC=C(C=C3)F)C |
Computed by PubChem (NCBI)