Products 1334546-32-5
CAS 1334546-32-5 is the registry number for 3-Amino-6-bromo-5-(trifluoromethyl)picolinic acid 95+%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
3-amino-6-bromo-5-(trifluoromethyl)pyridine-2-carboxylic acid (CAS 1334546-32-5) is a chemical compound with the molecular formula C7H4BrF3N2O2 and a molecular weight of 285.02 g/mol. IUPAC name: 3-amino-6-bromo-5-(trifluoromethyl)pyridine-2-carboxylic acid. InChIKey: JHFXTRXMLUVQKX-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF3N2O2 |
|---|---|
| Molecular weight | 285.02 g/mol |
| IUPAC name | 3-amino-6-bromo-5-(trifluoromethyl)pyridine-2-carboxylic acid |
| InChIKey | JHFXTRXMLUVQKX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=C1N)C(=O)O)Br)C(F)(F)F |
Computed by PubChem (NCBI)