Products 1438256-92-8
CAS 1438256-92-8 appears in our catalog under these names: 2-Amino-5-bromo-6-(trifluoromethyl)nicotinic acid, 98%, 2-Amino-5-bromo-6-(trifluoromethyl)nicotinic acid, 98%, 98%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g.
2-amino-5-bromo-6-(trifluoromethyl)pyridine-3-carboxylic acid (CAS 1438256-92-8) is a chemical compound with the molecular formula C7H4BrF3N2O2 and a molecular weight of 285.02 g/mol. IUPAC name: 2-amino-5-bromo-6-(trifluoromethyl)pyridine-3-carboxylic acid. InChIKey: BXSODHTWCPAUIR-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF3N2O2 |
|---|---|
| Molecular weight | 285.02 g/mol |
| IUPAC name | 2-amino-5-bromo-6-(trifluoromethyl)pyridine-3-carboxylic acid |
| InChIKey | BXSODHTWCPAUIR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=C1Br)C(F)(F)F)N)C(=O)O |
Computed by PubChem (NCBI)