Products 1445995-76-5
CAS 1445995-76-5 is the registry number for 2-Amino-6-bromo-3-nitrobenzotrifluoride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-bromo-6-nitro-2-(trifluoromethyl)aniline (CAS 1445995-76-5) is a chemical compound with the molecular formula C7H4BrF3N2O2 and a molecular weight of 285.02 g/mol. IUPAC name: 3-bromo-6-nitro-2-(trifluoromethyl)aniline. InChIKey: NRMNZTXRDFQCBL-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF3N2O2 |
|---|---|
| Molecular weight | 285.02 g/mol |
| IUPAC name | 3-bromo-6-nitro-2-(trifluoromethyl)aniline |
| InChIKey | NRMNZTXRDFQCBL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])N)C(F)(F)F)Br |
Computed by PubChem (NCBI)