CAS 1334652-46-8 appears in our catalog under these names: [1,1':4',1''-Terphenyl]-2,2''-dicarbaldehyde, 98%, 98%, [1,1':4',1''-Terphenyl]-2,2''-dicarbaldehyde, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-[4-(2-formylphenyl)phenyl]benzaldehyde (CAS 1334652-46-8) is a chemical compound with the molecular formula C20H14O2 and a molecular weight of 286.3 g/mol. IUPAC name: 2-[4-(2-formylphenyl)phenyl]benzaldehyde. InChIKey: PPLBZUGHMSZFLA-UHFFFAOYSA-N.
| Molecular formula | C20H14O2 |
|---|---|
| Molecular weight | 286.3 g/mol |
| IUPAC name | 2-[4-(2-formylphenyl)phenyl]benzaldehyde |
| InChIKey | PPLBZUGHMSZFLA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=O)C2=CC=C(C=C2)C3=CC=CC=C3C=O |
Computed by PubChem (NCBI)