Products 1335042-84-6

CAS 1335042-84-6 is the registry number for 3-(Fmoc-NH)-4-Cl-3-Me-butanoic acid. Offered by: Iris Biotech. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

4-chloro-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoic acid (CAS 1335042-84-6) is a chemical compound with the molecular formula C20H20ClNO4 and a molecular weight of 373.8 g/mol. IUPAC name: 4-chloro-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoic acid. InChIKey: IOAUVNOTPSLZIT-UHFFFAOYSA-N.

Identity
Molecular formulaC20H20ClNO4
Molecular weight373.8 g/mol
IUPAC name4-chloro-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoic acid
InChIKeyIOAUVNOTPSLZIT-UHFFFAOYSA-N
SMILESCC(CC(=O)O)(CCl)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13

Computed by PubChem (NCBI)