Products 2140264-30-6
CAS 2140264-30-6 is the registry number for trans-1-Benzyl 3-methyl 4-(4-chlorophenyl)pyrrolidine-1,3-dicarboxylate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g, 25g.
1-O-benzyl 3-O-methyl (3S,4R)-4-(4-chlorophenyl)pyrrolidine-1,3-dicarboxylate (CAS 2140264-30-6) is a chemical compound with the molecular formula C20H20ClNO4 and a molecular weight of 373.8 g/mol. IUPAC name: 1-O-benzyl 3-O-methyl (3S,4R)-4-(4-chlorophenyl)pyrrolidine-1,3-dicarboxylate. InChIKey: PZTQACCVRCVYJI-ZWKOTPCHSA-N.
| Molecular formula | C20H20ClNO4 |
|---|---|
| Molecular weight | 373.8 g/mol |
| IUPAC name | 1-O-benzyl 3-O-methyl (3S,4R)-4-(4-chlorophenyl)pyrrolidine-1,3-dicarboxylate |
| InChIKey | PZTQACCVRCVYJI-ZWKOTPCHSA-N |
| SMILES | COC(=O)[C@@H]1CN(C[C@H]1C2=CC=C(C=C2)Cl)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)