Products 71208-55-4

CAS 71208-55-4 is the registry number for Carprofen EP Impurity F. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Diethyl 2-(6-chloro-9H-carbazol-2-yl)-2-methylpropanedioate (CAS 71208-55-4) is a chemical compound with the molecular formula C20H20ClNO4 and a molecular weight of 373.8 g/mol. IUPAC name: diethyl 2-(6-chloro-9H-carbazol-2-yl)-2-methylpropanedioate. InChIKey: VCWSZWDBRMAJJJ-UHFFFAOYSA-N.

Identity
Molecular formulaC20H20ClNO4
Molecular weight373.8 g/mol
IUPAC namediethyl 2-(6-chloro-9H-carbazol-2-yl)-2-methylpropanedioate
InChIKeyVCWSZWDBRMAJJJ-UHFFFAOYSA-N
SMILESCCOC(=O)C(C)(C1=CC2=C(C=C1)C3=C(N2)C=CC(=C3)Cl)C(=O)OCC

Computed by PubChem (NCBI)