CAS 71208-55-4 is the registry number for Carprofen EP Impurity F. Offered by: Chemat Brand. Available pack sizes: on request.
Diethyl 2-(6-chloro-9H-carbazol-2-yl)-2-methylpropanedioate (CAS 71208-55-4) is a chemical compound with the molecular formula C20H20ClNO4 and a molecular weight of 373.8 g/mol. IUPAC name: diethyl 2-(6-chloro-9H-carbazol-2-yl)-2-methylpropanedioate. InChIKey: VCWSZWDBRMAJJJ-UHFFFAOYSA-N.
| Molecular formula | C20H20ClNO4 |
|---|---|
| Molecular weight | 373.8 g/mol |
| IUPAC name | diethyl 2-(6-chloro-9H-carbazol-2-yl)-2-methylpropanedioate |
| InChIKey | VCWSZWDBRMAJJJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(C1=CC2=C(C=C1)C3=C(N2)C=CC(=C3)Cl)C(=O)OCC |
Computed by PubChem (NCBI)