Products 1335052-39-5
CAS 1335052-39-5 is the registry number for 2,7-Dimethylimidazo[1,2-a]pyridine-3-sulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2,7-dimethylimidazo[1,2-a]pyridine-3-sulfonyl chloride (CAS 1335052-39-5) is a chemical compound with the molecular formula C9H9ClN2O2S and a molecular weight of 244.70 g/mol. IUPAC name: 2,7-dimethylimidazo[1,2-a]pyridine-3-sulfonyl chloride. InChIKey: STIJLIRFMRTLSI-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O2S |
|---|---|
| Molecular weight | 244.70 g/mol |
| IUPAC name | 2,7-dimethylimidazo[1,2-a]pyridine-3-sulfonyl chloride |
| InChIKey | STIJLIRFMRTLSI-UHFFFAOYSA-N |
| SMILES | CC1=CC2=NC(=C(N2C=C1)S(=O)(=O)Cl)C |
Computed by PubChem (NCBI)