CAS 472979-20-7 appears in our catalog under these names: 4-(2-AMINO-1,3-THIAZOL-4-YL)BENZENE-1,3-DIOL HYDROCHLORIDE, 95%, 95%, 4-(2-Aminothiazol-4-yl)benzene-1,3-diol hydrochloride, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg.
4-(2-amino-1,3-thiazol-4-yl)benzene-1,3-diol;hydrochloride (CAS 472979-20-7) is a chemical compound with the molecular formula C9H9ClN2O2S and a molecular weight of 244.70 g/mol. IUPAC name: 4-(2-amino-1,3-thiazol-4-yl)benzene-1,3-diol;hydrochloride. InChIKey: IKZHBUBOEHGRCO-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O2S |
|---|---|
| Molecular weight | 244.70 g/mol |
| IUPAC name | 4-(2-amino-1,3-thiazol-4-yl)benzene-1,3-diol;hydrochloride |
| InChIKey | IKZHBUBOEHGRCO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)O)C2=CSC(=N2)N.Cl |
Computed by PubChem (NCBI)