Products 1638768-82-7
CAS 1638768-82-7 is the registry number for 5-Chloro-3-(ethylsulfonyl)-1H-pyrrolo[3,2-b]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-3-ethylsulfonyl-1H-pyrrolo[3,2-b]pyridine (CAS 1638768-82-7) is a chemical compound with the molecular formula C9H9ClN2O2S and a molecular weight of 244.70 g/mol. IUPAC name: 5-chloro-3-ethylsulfonyl-1H-pyrrolo[3,2-b]pyridine. InChIKey: UEYSXOMVTKVRPH-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O2S |
|---|---|
| Molecular weight | 244.70 g/mol |
| IUPAC name | 5-chloro-3-ethylsulfonyl-1H-pyrrolo[3,2-b]pyridine |
| InChIKey | UEYSXOMVTKVRPH-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=CNC2=C1N=C(C=C2)Cl |
Computed by PubChem (NCBI)