CAS 1335571-45-3 is the registry number for (S)-6-chloro-7-methoxy-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-6-chloro-7-methoxy-1,2,3,4-tetrahydronaphthalen-1-amine (CAS 1335571-45-3) is a chemical compound with the molecular formula C11H14ClNO and a molecular weight of 211.69 g/mol. IUPAC name: (1S)-6-chloro-7-methoxy-1,2,3,4-tetrahydronaphthalen-1-amine. InChIKey: URIRDGOZQIDWRK-JTQLQIEISA-N.
| Molecular formula | C11H14ClNO |
|---|---|
| Molecular weight | 211.69 g/mol |
| IUPAC name | (1S)-6-chloro-7-methoxy-1,2,3,4-tetrahydronaphthalen-1-amine |
| InChIKey | URIRDGOZQIDWRK-JTQLQIEISA-N |
| SMILES | COC1=C(C=C2CCC[C@@H](C2=C1)N)Cl |
Computed by PubChem (NCBI)