CAS 1336229-78-7 is the registry number for 1-Naphthalenamine, 6-chloro-1,2,3,4-tetrahydro-7-methoxy-, (1R)-, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-6-chloro-7-methoxy-1,2,3,4-tetrahydronaphthalen-1-amine (CAS 1336229-78-7) is a chemical compound with the molecular formula C11H14ClNO and a molecular weight of 211.69 g/mol. IUPAC name: (1R)-6-chloro-7-methoxy-1,2,3,4-tetrahydronaphthalen-1-amine. InChIKey: URIRDGOZQIDWRK-SNVBAGLBSA-N.
| Molecular formula | C11H14ClNO |
|---|---|
| Molecular weight | 211.69 g/mol |
| IUPAC name | (1R)-6-chloro-7-methoxy-1,2,3,4-tetrahydronaphthalen-1-amine |
| InChIKey | URIRDGOZQIDWRK-SNVBAGLBSA-N |
| SMILES | COC1=C(C=C2CCC[C@H](C2=C1)N)Cl |
Computed by PubChem (NCBI)