Products 1335702-82-3
CAS 1335702-82-3 is the registry number for (S)-5-amino-3-fluoro-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(5S)-5-amino-3-fluoro-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid (CAS 1335702-82-3) is a chemical compound with the molecular formula C11H12FNO2 and a molecular weight of 209.22 g/mol. IUPAC name: (5S)-5-amino-3-fluoro-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid. InChIKey: XKBLOUKUUZVECM-JTQLQIEISA-N.
| Molecular formula | C11H12FNO2 |
|---|---|
| Molecular weight | 209.22 g/mol |
| IUPAC name | (5S)-5-amino-3-fluoro-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid |
| InChIKey | XKBLOUKUUZVECM-JTQLQIEISA-N |
| SMILES | C1C[C@@H](C2=C(C1)C(=CC(=C2)F)C(=O)O)N |
Computed by PubChem (NCBI)