Products 1260587-88-9
CAS 1260587-88-9 is the registry number for (3R,4S)-4-(4-Fluorophenyl)pyrrolidine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg, 1g.
(3R,4S)-4-(4-fluorophenyl)pyrrolidine-3-carboxylic acid (CAS 1260587-88-9) is a chemical compound with the molecular formula C11H12FNO2 and a molecular weight of 209.22 g/mol. IUPAC name: (3R,4S)-4-(4-fluorophenyl)pyrrolidine-3-carboxylic acid. InChIKey: YXKAESVIGMPPNB-ZJUUUORDSA-N.
| Molecular formula | C11H12FNO2 |
|---|---|
| Molecular weight | 209.22 g/mol |
| IUPAC name | (3R,4S)-4-(4-fluorophenyl)pyrrolidine-3-carboxylic acid |
| InChIKey | YXKAESVIGMPPNB-ZJUUUORDSA-N |
| SMILES | C1[C@@H]([C@H](CN1)C(=O)O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)