CAS 138469-95-1 appears in our catalog under these names: 3-(Dimethylamino)-1-(4-fluoro-2-hydroxyphenyl)prop-2-en-1-one, 95%, (2E)-3-(Dimethylamino)-1-(4-fluoro-2-hydroxyphenyl)prop-2-en-1-one, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
(E)-3-(dimethylamino)-1-(4-fluoro-2-hydroxyphenyl)prop-2-en-1-one (CAS 138469-95-1) is a chemical compound with the molecular formula C11H12FNO2 and a molecular weight of 209.22 g/mol. IUPAC name: (E)-3-(dimethylamino)-1-(4-fluoro-2-hydroxyphenyl)prop-2-en-1-one. InChIKey: KSHPNEYOOPCWGC-AATRIKPKSA-N.
| Molecular formula | C11H12FNO2 |
|---|---|
| Molecular weight | 209.22 g/mol |
| IUPAC name | (E)-3-(dimethylamino)-1-(4-fluoro-2-hydroxyphenyl)prop-2-en-1-one |
| InChIKey | KSHPNEYOOPCWGC-AATRIKPKSA-N |
| SMILES | CN(C)/C=C/C(=O)C1=C(C=C(C=C1)F)O |
Computed by PubChem (NCBI)