Products 338404-21-0
CAS 338404-21-0 is the registry number for 4-Fluorophenyl (2e)-3-(dimethylamino)prop-2-enoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
(4-fluorophenyl) (E)-3-(dimethylamino)prop-2-enoate (CAS 338404-21-0) is a chemical compound with the molecular formula C11H12FNO2 and a molecular weight of 209.22 g/mol. IUPAC name: (4-fluorophenyl) (E)-3-(dimethylamino)prop-2-enoate. InChIKey: JIMXLSDLPAULLJ-BQYQJAHWSA-N.
| Molecular formula | C11H12FNO2 |
|---|---|
| Molecular weight | 209.22 g/mol |
| IUPAC name | (4-fluorophenyl) (E)-3-(dimethylamino)prop-2-enoate |
| InChIKey | JIMXLSDLPAULLJ-BQYQJAHWSA-N |
| SMILES | CN(C)/C=C/C(=O)OC1=CC=C(C=C1)F |
Computed by PubChem (NCBI)