Products 13366-01-3
CAS 13366-01-3 is the registry number for 2-Methyl-2-(naphthalen-1-yl)propanoic acid, 95%. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-methyl-2-naphthalen-1-ylpropanoic acid (CAS 13366-01-3) is a chemical compound with the molecular formula C14H14O2 and a molecular weight of 214.26 g/mol. IUPAC name: 2-methyl-2-naphthalen-1-ylpropanoic acid. InChIKey: GCOOBWJNMRZHBR-UHFFFAOYSA-N.
| Molecular formula | C14H14O2 |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | 2-methyl-2-naphthalen-1-ylpropanoic acid |
| InChIKey | GCOOBWJNMRZHBR-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=CC2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-methyl-2-(naphthalen-1-yl)propanoic acid, 2-methyl-2-naphthalen-1-ylpropanoic acid, 2-Methyl-2-(1-naphthyl)propanoic acid, .alpha.-1-Naphthylisobutyric acid, 1-naphthaleneacetic acid, alpha,alpha-dimethyl-, GCOOBWJNMRZHBR-UHFFFAOYSA-N, 2-Methyl-2-(1-naphthyl)propanoic acid #, 2-methyl-2-(naphthalen-1-yl)propanoicacid, alpha,alpha-Dimethyl-1-naphthaleneacetic acid