CAS 1336874-02-2 is the registry number for 1-BOC-4-(2,2-Dimethyl-4,6-dioxo-[1,3]dioxane-5-carbonyl)piperidine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Tert-butyl 4-(2,2-dimethyl-4,6-dioxo-1,3-dioxane-5-carbonyl)piperidine-1-carboxylate (CAS 1336874-02-2) is a chemical compound with the molecular formula C17H25NO7 and a molecular weight of 355.4 g/mol. IUPAC name: tert-butyl 4-(2,2-dimethyl-4,6-dioxo-1,3-dioxane-5-carbonyl)piperidine-1-carboxylate. InChIKey: FLLXQDIQYCBDHG-UHFFFAOYSA-N.
| Molecular formula | C17H25NO7 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | tert-butyl 4-(2,2-dimethyl-4,6-dioxo-1,3-dioxane-5-carbonyl)piperidine-1-carboxylate |
| InChIKey | FLLXQDIQYCBDHG-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)C(C(=O)O1)C(=O)C2CCN(CC2)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)