CAS 477254-82-3 appears in our catalog under these names: (S)-2-((tert-Butoxycarbonyl)amino)-3-(3,4,5-trimethoxyphenyl)propanoic acid, 98%, Boc-L-Phe(3,4,5-OMe3)-OH. Offered by: AmBeed, Iris Biotech. Available pack sizes: 5g, 100mg, 1g, 50mg, 250mg.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3,4,5-trimethoxyphenyl)propanoic acid (CAS 477254-82-3) is a chemical compound with the molecular formula C17H25NO7 and a molecular weight of 355.4 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3,4,5-trimethoxyphenyl)propanoic acid. InChIKey: ZVGAWGZORXNQJF-NSHDSACASA-N.
| Molecular formula | C17H25NO7 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3,4,5-trimethoxyphenyl)propanoic acid |
| InChIKey | ZVGAWGZORXNQJF-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC(=C(C(=C1)OC)OC)OC)C(=O)O |
Computed by PubChem (NCBI)