CAS 1336911-98-8 is the registry number for 4-Methyl Buphedrone Hydrochloride. Offered by: TRC. Available pack sizes: 100mg.
2-(methylamino)-1-(4-methylphenyl)butan-1-one;hydrochloride (CAS 1336911-98-8) is a chemical compound with the molecular formula C12H18ClNO and a molecular weight of 227.73 g/mol. IUPAC name: 2-(methylamino)-1-(4-methylphenyl)butan-1-one;hydrochloride. InChIKey: CNSOPRIVFKVRDH-UHFFFAOYSA-N.
| Molecular formula | C12H18ClNO |
|---|---|
| Molecular weight | 227.73 g/mol |
| IUPAC name | 2-(methylamino)-1-(4-methylphenyl)butan-1-one;hydrochloride |
| InChIKey | CNSOPRIVFKVRDH-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)C1=CC=C(C=C1)C)NC.Cl |
Computed by PubChem (NCBI)