Products 133697-22-0
CAS 133697-22-0 is the registry number for 2,3-Anhydro-4,6-O-benzylidene-N-(tert-butoxycarbonyl)-1,5-deoxy-1,5-imino-D-glucitol. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 2mg, 5mg, 25mg, 50mg.
Tert-butyl (1R,2S)-10-phenyl-3,9,11-trioxa-6-azatricyclo[5.4.0.02,4]undecane-6-carboxylate (CAS 133697-22-0) is a chemical compound with the molecular formula C18H23NO5 and a molecular weight of 333.4 g/mol. IUPAC name: tert-butyl (1R,2S)-10-phenyl-3,9,11-trioxa-6-azatricyclo[5.4.0.02,4]undecane-6-carboxylate. InChIKey: QQJPAXYKZQBUAX-MJHWXPEHSA-N.
| Molecular formula | C18H23NO5 |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | tert-butyl (1R,2S)-10-phenyl-3,9,11-trioxa-6-azatricyclo[5.4.0.02,4]undecane-6-carboxylate |
| InChIKey | QQJPAXYKZQBUAX-MJHWXPEHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2[C@H](O2)[C@H]3C1COC(O3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)