Products 133706-65-7
CAS 133706-65-7 appears in our catalog under these names: H–Gly–D–Tyr–OH, H-Gly-D-Tyr-OH. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1g, 5g, 1000mg, 2000mg, 5000mg, Get quote.
(2R)-2-[(2-aminoacetyl)amino]-3-(4-hydroxyphenyl)propanoic acid (CAS 133706-65-7) is a chemical compound with the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. IUPAC name: (2R)-2-[(2-aminoacetyl)amino]-3-(4-hydroxyphenyl)propanoic acid. InChIKey: XBGGUPMXALFZOT-SECBINFHSA-N.
| Molecular formula | C11H14N2O4 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | (2R)-2-[(2-aminoacetyl)amino]-3-(4-hydroxyphenyl)propanoic acid |
| InChIKey | XBGGUPMXALFZOT-SECBINFHSA-N |
| SMILES | C1=CC(=CC=C1C[C@H](C(=O)O)NC(=O)CN)O |
Computed by PubChem (NCBI)