Products 133728-28-6

CAS 133728-28-6 is the registry number for Tert-butyl (10-oxodecyl)carbamate, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-(10-oxodecyl)carbamate (CAS 133728-28-6) is a chemical compound with the molecular formula C15H29NO3 and a molecular weight of 271.40 g/mol. IUPAC name: tert-butyl N-(10-oxodecyl)carbamate. InChIKey: INYHKACVYCYIQO-UHFFFAOYSA-N.

Identity
Molecular formulaC15H29NO3
Molecular weight271.40 g/mol
IUPAC nametert-butyl N-(10-oxodecyl)carbamate
InChIKeyINYHKACVYCYIQO-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NCCCCCCCCCC=O

Computed by PubChem (NCBI)