Products 191725-50-5

CAS 191725-50-5 is the registry number for tert-Butyl 4-(5-hydroxypentyl)piperidine-1-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl 4-(5-hydroxypentyl)piperidine-1-carboxylate (CAS 191725-50-5) is a chemical compound with the molecular formula C15H29NO3 and a molecular weight of 271.40 g/mol. IUPAC name: tert-butyl 4-(5-hydroxypentyl)piperidine-1-carboxylate. InChIKey: DCIQIRHJTHCWLD-UHFFFAOYSA-N.

Identity
Molecular formulaC15H29NO3
Molecular weight271.40 g/mol
IUPAC nametert-butyl 4-(5-hydroxypentyl)piperidine-1-carboxylate
InChIKeyDCIQIRHJTHCWLD-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(CC1)CCCCCO

Computed by PubChem (NCBI)