Products 1455080-10-0

CAS 1455080-10-0 is the registry number for 2-(Dihexylcarbamoyl)acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

3-(dihexylamino)-3-oxopropanoic acid (CAS 1455080-10-0) is a chemical compound with the molecular formula C15H29NO3 and a molecular weight of 271.40 g/mol. IUPAC name: 3-(dihexylamino)-3-oxopropanoic acid. InChIKey: AIHQUMSKDDENBY-UHFFFAOYSA-N.

Identity
Molecular formulaC15H29NO3
Molecular weight271.40 g/mol
IUPAC name3-(dihexylamino)-3-oxopropanoic acid
InChIKeyAIHQUMSKDDENBY-UHFFFAOYSA-N
SMILESCCCCCCN(CCCCCC)C(=O)CC(=O)O

Computed by PubChem (NCBI)