CAS 13373-32-5 appears in our catalog under these names: 2-Isopropyl-4-nitro-1h-imidazole, 95%, N-Desmethyl Ipronidazole, Ipronidazole-N-desmethyl, 2–Isopropyl–4–nitro–1H–imidazole. Offered by: Combi-blocks, TRC, Dr. Ehrenstorfer, GLPBio, HPC Standards. Available pack sizes: 250mg, 1g, 5g, 10mg, 25mg, 5mg, 100mg, 1x10mg.
5-nitro-2-propan-2-yl-1H-imidazole (CAS 13373-32-5) is a chemical compound with the molecular formula C6H9N3O2 and a molecular weight of 155.15 g/mol. IUPAC name: 5-nitro-2-propan-2-yl-1H-imidazole. InChIKey: SQZCZXRYOJJCDU-UHFFFAOYSA-N.
| Molecular formula | C6H9N3O2 |
|---|---|
| Molecular weight | 155.15 g/mol |
| IUPAC name | 5-nitro-2-propan-2-yl-1H-imidazole |
| InChIKey | SQZCZXRYOJJCDU-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC=C(N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)