CAS 1337386-56-7 is the registry number for 7-Bromo-5-fluorochroman-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-5-fluoro-3,4-dihydro-2H-chromen-3-amine (CAS 1337386-56-7) is a chemical compound with the molecular formula C9H9BrFNO and a molecular weight of 246.08 g/mol. IUPAC name: 7-bromo-5-fluoro-3,4-dihydro-2H-chromen-3-amine. InChIKey: PUXILIBOJNIDCY-UHFFFAOYSA-N.
| Molecular formula | C9H9BrFNO |
|---|---|
| Molecular weight | 246.08 g/mol |
| IUPAC name | 7-bromo-5-fluoro-3,4-dihydro-2H-chromen-3-amine |
| InChIKey | PUXILIBOJNIDCY-UHFFFAOYSA-N |
| SMILES | C1C(COC2=C1C(=CC(=C2)Br)F)N |
Computed by PubChem (NCBI)